C17H24N2O5S — CID 7503503
N-[(3S)-1,1-dioxothiolan-3-yl]-N',N'-dimethyl-2-(4-propanoylphenoxy)acetohydrazide (PubChem CID 7503503) has the molecular formula C17H24N2O5S and a molecular weight of 368.46 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-N',N'-dimethyl-2-(4-propanoylphenoxy)acetohydrazide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-N',N'-dimethyl-2-(4-propanoylphenoxy)acetohydrazide |
|---|---|
| PubChem CID | 7503503 |
| Molecular Formula | C17H24N2O5S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-N',N'-dimethyl-2-(4-propanoylphenoxy)acetohydrazide |
| SMILES | CCC(=O)c1ccc(OCC(=O)N([C@H]2CCS(=O)(=O)C2)N(C)C)cc1 |
| InChI | InChI=1S/C17H24N2O5S/c1-4-16(20)13-5-7-15(8-6-13)24-11-17(21)19(18(2)3)14-9-10-25(22,23)12-14/h5-8,14H,4,9-12H2,1-3H3/t14-/m0/s1 |
| InChIKey | PJYBGWCPVDWBRJ-AWEZNQCLSA-N |
| XLogP | 1.15 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|