C20H27NO5S — CID 30824688
2-(4-acetylphenoxy)-N-cyclohexyl-N-[(3S)-1,1-dioxothiolan-3-yl]acetamide (PubChem CID 30824688) has the molecular formula C20H27NO5S and a molecular weight of 393.51 g/mol. Its IUPAC name is 2-(4-acetylphenoxy)-N-cyclohexyl-N-[(3S)-1,1-dioxothiolan-3-yl]acetamide.
| Compound Name | 2-(4-acetylphenoxy)-N-cyclohexyl-N-[(3S)-1,1-dioxothiolan-3-yl]acetamide |
|---|---|
| PubChem CID | 30824688 |
| Molecular Formula | C20H27NO5S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 2-(4-acetylphenoxy)-N-cyclohexyl-N-[(3S)-1,1-dioxothiolan-3-yl]acetamide |
| SMILES | CC(=O)c1ccc(OCC(=O)N(C2CCCCC2)[C@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C20H27NO5S/c1-15(22)16-7-9-19(10-8-16)26-13-20(23)21(17-5-3-2-4-6-17)18-11-12-27(24,25)14-18/h7-10,17-18H,2-6,11-14H2,1H3/t18-/m0/s1 |
| InChIKey | MLTGOTFPCJRXBE-SFHVURJKSA-N |
| XLogP | 2.62 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |