C17H26N2O4S — CID 55640454
N-(1,1-dioxothiolan-3-yl)-N',N'-dimethyl-2-(3-propan-2-ylphenoxy)acetohydrazide (PubChem CID 55640454) has the molecular formula C17H26N2O4S and a molecular weight of 354.47 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N',N'-dimethyl-2-(3-propan-2-ylphenoxy)acetohydrazide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N',N'-dimethyl-2-(3-propan-2-ylphenoxy)acetohydrazide |
|---|---|
| PubChem CID | 55640454 |
| Molecular Formula | C17H26N2O4S |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N',N'-dimethyl-2-(3-propan-2-ylphenoxy)acetohydrazide |
| SMILES | CC(C)c1cccc(OCC(=O)N(C2CCS(=O)(=O)C2)N(C)C)c1 |
| InChI | InChI=1S/C17H26N2O4S/c1-13(2)14-6-5-7-16(10-14)23-11-17(20)19(18(3)4)15-8-9-24(21,22)12-15/h5-7,10,13,15H,8-9,11-12H2,1-4H3 |
| InChIKey | MWGUJRLQXBRPMX-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|