C18H28N2O4S — CID 7503497
N-[(3R)-1,1-dioxothiolan-3-yl]-N',N'-dimethyl-2-(5-methyl-2-propan-2-ylphenoxy)acetohydrazide (PubChem CID 7503497) has the molecular formula C18H28N2O4S and a molecular weight of 368.50 g/mol. Its IUPAC name is N-[(3R)-1,1-dioxothiolan-3-yl]-N',N'-dimethyl-2-(5-methyl-2-propan-2-ylphenoxy)acetohydrazide.
| Compound Name | N-[(3R)-1,1-dioxothiolan-3-yl]-N',N'-dimethyl-2-(5-methyl-2-propan-2-ylphenoxy)acetohydrazide |
|---|---|
| PubChem CID | 7503497 |
| Molecular Formula | C18H28N2O4S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | N-[(3R)-1,1-dioxothiolan-3-yl]-N',N'-dimethyl-2-(5-methyl-2-propan-2-ylphenoxy)acetohydrazide |
| SMILES | Cc1ccc(C(C)C)c(OCC(=O)N([C@@H]2CCS(=O)(=O)C2)N(C)C)c1 |
| InChI | InChI=1S/C18H28N2O4S/c1-13(2)16-7-6-14(3)10-17(16)24-11-18(21)20(19(4)5)15-8-9-25(22,23)12-15/h6-7,10,13,15H,8-9,11-12H2,1-5H3/t15-/m1/s1 |
| InChIKey | AKPQWDGSWWTVGK-OAHLLOKOSA-N |
| XLogP | 1.99 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|