C15H18N2O4S — CID 16540663
2-(4-cyanophenoxy)-N-(1,1-dioxothiolan-3-yl)-N-ethylacetamide (PubChem CID 16540663) has the molecular formula C15H18N2O4S and a molecular weight of 322.39 g/mol. Its IUPAC name is 2-(4-cyanophenoxy)-N-(1,1-dioxothiolan-3-yl)-N-ethylacetamide.
| Compound Name | 2-(4-cyanophenoxy)-N-(1,1-dioxothiolan-3-yl)-N-ethylacetamide |
|---|---|
| PubChem CID | 16540663 |
| Molecular Formula | C15H18N2O4S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 2-(4-cyanophenoxy)-N-(1,1-dioxothiolan-3-yl)-N-ethylacetamide |
| SMILES | CCN(C(=O)COc1ccc(C#N)cc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H18N2O4S/c1-2-17(13-7-8-22(19,20)11-13)15(18)10-21-14-5-3-12(9-16)4-6-14/h3-6,13H,2,7-8,10-11H2,1H3 |
| InChIKey | LYXQKICYKWBXNA-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |