C11H20N2O5S — CID 60830125
2-[tert-butylcarbamoyl-(1,1-dioxothiolan-3-yl)amino]acetic acid (PubChem CID 60830125) has the molecular formula C11H20N2O5S and a molecular weight of 292.36 g/mol. Its IUPAC name is 2-[tert-butylcarbamoyl-(1,1-dioxothiolan-3-yl)amino]acetic acid.
| Compound Name | 2-[tert-butylcarbamoyl-(1,1-dioxothiolan-3-yl)amino]acetic acid |
|---|---|
| PubChem CID | 60830125 |
| Molecular Formula | C11H20N2O5S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 2-[tert-butylcarbamoyl-(1,1-dioxothiolan-3-yl)amino]acetic acid |
| SMILES | CC(C)(C)NC(=O)N(CC(=O)O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H20N2O5S/c1-11(2,3)12-10(16)13(6-9(14)15)8-4-5-19(17,18)7-8/h8H,4-7H2,1-3H3,(H,12,16)(H,14,15) |
| InChIKey | OUNRHUAUHWKKLM-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |