C11H17NO5S — CID 60846246
2-[(1,1-dioxothiolan-3-yl)-(3-methylbut-2-enoyl)amino]acetic acid (PubChem CID 60846246) has the molecular formula C11H17NO5S and a molecular weight of 275.33 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)-(3-methylbut-2-enoyl)amino]acetic acid.
| Compound Name | 2-[(1,1-dioxothiolan-3-yl)-(3-methylbut-2-enoyl)amino]acetic acid |
|---|---|
| PubChem CID | 60846246 |
| Molecular Formula | C11H17NO5S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 2-[(1,1-dioxothiolan-3-yl)-(3-methylbut-2-enoyl)amino]acetic acid |
| SMILES | CC(C)=CC(=O)N(CC(=O)O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H17NO5S/c1-8(2)5-10(13)12(6-11(14)15)9-3-4-18(16,17)7-9/h5,9H,3-4,6-7H2,1-2H3,(H,14,15) |
| InChIKey | OBPMARSTSAMPDG-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|