C11H19NO4S — CID 114473118
2-[(1,1-dioxothiolan-3-yl)-(3-methylbut-3-enyl)amino]acetic acid (PubChem CID 114473118) has the molecular formula C11H19NO4S and a molecular weight of 261.34 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)-(3-methylbut-3-enyl)amino]acetic acid.
| Compound Name | 2-[(1,1-dioxothiolan-3-yl)-(3-methylbut-3-enyl)amino]acetic acid |
|---|---|
| PubChem CID | 114473118 |
| Molecular Formula | C11H19NO4S |
| Molecular Weight | 261.34 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 2-[(1,1-dioxothiolan-3-yl)-(3-methylbut-3-enyl)amino]acetic acid |
| SMILES | C=C(C)CCN(CC(=O)O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H19NO4S/c1-9(2)3-5-12(7-11(13)14)10-4-6-17(15,16)8-10/h10H,1,3-8H2,2H3,(H,13,14) |
| InChIKey | JNWYQIDRIFOBTH-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.34 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|