C8H15NO6S2 — CID 60675324
2-[(1,1-dioxothiolan-3-yl)-ethylsulfonylamino]acetic acid (PubChem CID 60675324) has the molecular formula C8H15NO6S2 and a molecular weight of 285.34 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)-ethylsulfonylamino]acetic acid.
| Compound Name | 2-[(1,1-dioxothiolan-3-yl)-ethylsulfonylamino]acetic acid |
|---|---|
| PubChem CID | 60675324 |
| Molecular Formula | C8H15NO6S2 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.03 |
| IUPAC Name | 2-[(1,1-dioxothiolan-3-yl)-ethylsulfonylamino]acetic acid |
| SMILES | CCS(=O)(=O)N(CC(=O)O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H15NO6S2/c1-2-17(14,15)9(5-8(10)11)7-3-4-16(12,13)6-7/h7H,2-6H2,1H3,(H,10,11) |
| InChIKey | TVFOUKCYHZMJEP-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 108.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |