C9H17NO6S2 — CID 61454198
2-[(1,1-dioxothiolan-3-yl)-ethylsulfamoyl]propanoic acid (PubChem CID 61454198) has the molecular formula C9H17NO6S2 and a molecular weight of 299.37 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)-ethylsulfamoyl]propanoic acid.
| Compound Name | 2-[(1,1-dioxothiolan-3-yl)-ethylsulfamoyl]propanoic acid |
|---|---|
| PubChem CID | 61454198 |
| Molecular Formula | C9H17NO6S2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 2-[(1,1-dioxothiolan-3-yl)-ethylsulfamoyl]propanoic acid |
| SMILES | CCN(C1CCS(=O)(=O)C1)S(=O)(=O)C(C)C(=O)O |
| InChI | InChI=1S/C9H17NO6S2/c1-3-10(8-4-5-17(13,14)6-8)18(15,16)7(2)9(11)12/h7-8H,3-6H2,1-2H3,(H,11,12) |
| InChIKey | FEVAZVDYDROKID-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 108.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |