C7H14BrNO4S2 — CID 83084951
1-bromo-N-(1,1-dioxothiolan-3-yl)-N-ethylmethanesulfonamide (PubChem CID 83084951) has the molecular formula C7H14BrNO4S2 and a molecular weight of 320.23 g/mol. Its IUPAC name is 1-bromo-N-(1,1-dioxothiolan-3-yl)-N-ethylmethanesulfonamide.
| Compound Name | 1-bromo-N-(1,1-dioxothiolan-3-yl)-N-ethylmethanesulfonamide |
|---|---|
| PubChem CID | 83084951 |
| Molecular Formula | C7H14BrNO4S2 |
| Molecular Weight | 320.23 g/mol |
| Exact Mass | 318.95 |
| IUPAC Name | 1-bromo-N-(1,1-dioxothiolan-3-yl)-N-ethylmethanesulfonamide |
| SMILES | CCN(C1CCS(=O)(=O)C1)S(=O)(=O)CBr |
| InChI | InChI=1S/C7H14BrNO4S2/c1-2-9(15(12,13)6-8)7-3-4-14(10,11)5-7/h7H,2-6H2,1H3 |
| InChIKey | MDYYPHUJJADIAR-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.23 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|