C8H15NO4S — CID 20985922
2-[(1,1-dioxothiolan-3-yl)-methylamino]propanoic acid (PubChem CID 20985922) has the molecular formula C8H15NO4S and a molecular weight of 221.28 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)-methylamino]propanoic acid.
| Compound Name | 2-[(1,1-dioxothiolan-3-yl)-methylamino]propanoic acid |
|---|---|
| PubChem CID | 20985922 |
| Molecular Formula | C8H15NO4S |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 2-[(1,1-dioxothiolan-3-yl)-methylamino]propanoic acid |
| SMILES | CC(C(=O)O)N(C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H15NO4S/c1-6(8(10)11)9(2)7-3-4-14(12,13)5-7/h6-7H,3-5H2,1-2H3,(H,10,11) |
| InChIKey | VISONJKVLQAQGR-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |