C8H16N2O3S — CID 7282876
1-[(3R)-1,1-dioxothiolan-3-yl]-1,3,3-trimethylurea (PubChem CID 7282876) has the molecular formula C8H16N2O3S and a molecular weight of 220.29 g/mol. Its IUPAC name is 1-[(3R)-1,1-dioxothiolan-3-yl]-1,3,3-trimethylurea.
| Compound Name | 1-[(3R)-1,1-dioxothiolan-3-yl]-1,3,3-trimethylurea |
|---|---|
| PubChem CID | 7282876 |
| Molecular Formula | C8H16N2O3S |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | 1-[(3R)-1,1-dioxothiolan-3-yl]-1,3,3-trimethylurea |
| SMILES | CN(C)C(=O)N(C)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H16N2O3S/c1-9(2)8(11)10(3)7-4-5-14(12,13)6-7/h7H,4-6H2,1-3H3/t7-/m1/s1 |
| InChIKey | YBDUCJOFQJTISO-SSDOTTSWSA-N |
| XLogP | -0.21 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |