C6H10NO3S2- — CID 7059128
N-[(3R)-1,1-dioxothiolan-3-yl]-N-methylcarbamothioate (PubChem CID 7059128) has the molecular formula C6H10NO3S2- and a molecular weight of 208.28 g/mol. Its IUPAC name is N-[(3R)-1,1-dioxothiolan-3-yl]-N-methylcarbamothioate.
| Compound Name | N-[(3R)-1,1-dioxothiolan-3-yl]-N-methylcarbamothioate |
|---|---|
| PubChem CID | 7059128 |
| Molecular Formula | C6H10NO3S2- |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.01 |
| IUPAC Name | N-[(3R)-1,1-dioxothiolan-3-yl]-N-methylcarbamothioate |
| SMILES | CN(C(=O)[S-])[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C6H11NO3S2/c1-7(6(8)11)5-2-3-12(9,10)4-5/h5H,2-4H2,1H3,(H,8,11)/p-1/t5-/m1/s1 |
| InChIKey | JEFNCFDHXFVOTJ-RXMQYKEDSA-M |
| XLogP | -0.23 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|