C6H10KNO2S3 — CID 2772232
potassium N-(1,1-dioxothiolan-3-yl)-N-methylcarbamodithioate (PubChem CID 2772232) has the molecular formula C6H10KNO2S3 and a molecular weight of 263.45 g/mol. Its IUPAC name is potassium N-(1,1-dioxothiolan-3-yl)-N-methylcarbamodithioate.
| Compound Name | potassium N-(1,1-dioxothiolan-3-yl)-N-methylcarbamodithioate |
|---|---|
| PubChem CID | 2772232 |
| Molecular Formula | C6H10KNO2S3 |
| Molecular Weight | 263.45 g/mol |
| Exact Mass | 262.95 |
| IUPAC Name | potassium N-(1,1-dioxothiolan-3-yl)-N-methylcarbamodithioate |
| SMILES | CN(C(=S)[S-])C1CCS(=O)(=O)C1.[K+] |
| InChI | InChI=1S/C6H11NO2S3.K/c1-7(6(10)11)5-2-3-12(8,9)4-5;/h5H,2-4H2,1H3,(H,10,11);/q;+1/p-1 |
| InChIKey | REMALOBYKCHEPV-UHFFFAOYSA-M |
| XLogP | -3.06 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.45 |
| LogP ≤ 5 | -3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|