C9H15NO2S3 — CID 3784415
prop-2-enyl N-(1,1-dioxothiolan-3-yl)-N-methylcarbamodithioate (PubChem CID 3784415) has the molecular formula C9H15NO2S3 and a molecular weight of 265.42 g/mol. Its IUPAC name is prop-2-enyl N-(1,1-dioxothiolan-3-yl)-N-methylcarbamodithioate.
| Compound Name | prop-2-enyl N-(1,1-dioxothiolan-3-yl)-N-methylcarbamodithioate |
|---|---|
| PubChem CID | 3784415 |
| Molecular Formula | C9H15NO2S3 |
| Molecular Weight | 265.42 g/mol |
| Exact Mass | 265.03 |
| IUPAC Name | prop-2-enyl N-(1,1-dioxothiolan-3-yl)-N-methylcarbamodithioate |
| SMILES | C=CCSC(=S)N(C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H15NO2S3/c1-3-5-14-9(13)10(2)8-4-6-15(11,12)7-8/h3,8H,1,4-7H2,2H3 |
| InChIKey | ZWPIDUZXFRPQGB-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.42 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|