C11H17NO4S4 — CID 7470368
(1,1-dioxo-2,5-dihydrothiophen-3-yl)methyl N-[(3S)-1,1-dioxothiolan-3-yl]-N-methylcarbamodithioate (PubChem CID 7470368) has the molecular formula C11H17NO4S4 and a molecular weight of 355.53 g/mol. Its IUPAC name is (1,1-dioxo-2,5-dihydrothiophen-3-yl)methyl N-[(3S)-1,1-dioxothiolan-3-yl]-N-methylcarbamodithioate.
| Compound Name | (1,1-dioxo-2,5-dihydrothiophen-3-yl)methyl N-[(3S)-1,1-dioxothiolan-3-yl]-N-methylcarbamodithioate |
|---|---|
| PubChem CID | 7470368 |
| Molecular Formula | C11H17NO4S4 |
| Molecular Weight | 355.53 g/mol |
| Exact Mass | 355.00 |
| IUPAC Name | (1,1-dioxo-2,5-dihydrothiophen-3-yl)methyl N-[(3S)-1,1-dioxothiolan-3-yl]-N-methylcarbamodithioate |
| SMILES | CN(C(=S)SCC1=CCS(=O)(=O)C1)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H17NO4S4/c1-12(10-3-5-20(15,16)8-10)11(17)18-6-9-2-4-19(13,14)7-9/h2,10H,3-8H2,1H3/t10-/m0/s1 |
| InChIKey | LLZLTLNDJSZBGN-JTQLQIEISA-N |
| XLogP | 0.48 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.53 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|