C6H15N2O2S3+ — CID 21177645
azanium (1,1-dioxothiolan-3-yl)-methylcarbamodithioic acid (PubChem CID 21177645) has the molecular formula C6H15N2O2S3+ and a molecular weight of 243.40 g/mol. Its IUPAC name is azanium (1,1-dioxothiolan-3-yl)-methylcarbamodithioic acid.
| Compound Name | azanium (1,1-dioxothiolan-3-yl)-methylcarbamodithioic acid |
|---|---|
| PubChem CID | 21177645 |
| Molecular Formula | C6H15N2O2S3+ |
| Molecular Weight | 243.40 g/mol |
| Exact Mass | 243.03 |
| IUPAC Name | azanium (1,1-dioxothiolan-3-yl)-methylcarbamodithioic acid |
| SMILES | CN(C(=S)S)C1CCS(=O)(=O)C1.[NH4+] |
| InChI | InChI=1S/C6H11NO2S3.H3N/c1-7(6(10)11)5-2-3-12(8,9)4-5;/h5H,2-4H2,1H3,(H,10,11);1H3/p+1 |
| InChIKey | QGVSJKMXDDBQFY-UHFFFAOYSA-O |
| XLogP | 0.70 |
| TPSA | 73.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.40 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|