C6H10NO2S3- — CID 7058890
N-[(3S)-1,1-dioxothiolan-3-yl]-N-methylcarbamodithioate (PubChem CID 7058890) has the molecular formula C6H10NO2S3- and a molecular weight of 224.35 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-N-methylcarbamodithioate.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-N-methylcarbamodithioate |
|---|---|
| PubChem CID | 7058890 |
| Molecular Formula | C6H10NO2S3- |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 223.99 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-N-methylcarbamodithioate |
| SMILES | CN(C(=S)[S-])[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C6H11NO2S3/c1-7(6(10)11)5-2-3-12(8,9)4-5/h5H,2-4H2,1H3,(H,10,11)/p-1/t5-/m0/s1 |
| InChIKey | LAKQCODOICODCV-YFKPBYRVSA-M |
| XLogP | -0.06 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|