C6H13N3O2S2 — CID 82287182
3-amino-1-(1,1-dioxothiolan-3-yl)-1-methylthiourea (PubChem CID 82287182) has the molecular formula C6H13N3O2S2 and a molecular weight of 223.32 g/mol. Its IUPAC name is 3-amino-1-(1,1-dioxothiolan-3-yl)-1-methylthiourea.
| Compound Name | 3-amino-1-(1,1-dioxothiolan-3-yl)-1-methylthiourea |
|---|---|
| PubChem CID | 82287182 |
| Molecular Formula | C6H13N3O2S2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.04 |
| IUPAC Name | 3-amino-1-(1,1-dioxothiolan-3-yl)-1-methylthiourea |
| SMILES | CN(C(=S)NN)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C6H13N3O2S2/c1-9(6(12)8-7)5-2-3-13(10,11)4-5/h5H,2-4,7H2,1H3,(H,8,12) |
| InChIKey | XRFYWEAYWDROEA-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|