C10H20N2O3S2 — CID 113218995
1-(1,1-dioxothiolan-3-yl)-3-(3-methoxypropyl)-1-methylthiourea (PubChem CID 113218995) has the molecular formula C10H20N2O3S2 and a molecular weight of 280.41 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-(3-methoxypropyl)-1-methylthiourea.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-(3-methoxypropyl)-1-methylthiourea |
|---|---|
| PubChem CID | 113218995 |
| Molecular Formula | C10H20N2O3S2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-(3-methoxypropyl)-1-methylthiourea |
| SMILES | COCCCNC(=S)N(C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H20N2O3S2/c1-12(9-4-7-17(13,14)8-9)10(16)11-5-3-6-15-2/h9H,3-8H2,1-2H3,(H,11,16) |
| InChIKey | OKPGXXMXZKXNRK-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|