C15H21ClN2O3S2 — CID 9098072
3-(4-chlorophenyl)-1-[(3R)-1,1-dioxothiolan-3-yl]-1-(3-methoxypropyl)thiourea (PubChem CID 9098072) has the molecular formula C15H21ClN2O3S2 and a molecular weight of 376.93 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-[(3R)-1,1-dioxothiolan-3-yl]-1-(3-methoxypropyl)thiourea.
| Compound Name | 3-(4-chlorophenyl)-1-[(3R)-1,1-dioxothiolan-3-yl]-1-(3-methoxypropyl)thiourea |
|---|---|
| PubChem CID | 9098072 |
| Molecular Formula | C15H21ClN2O3S2 |
| Molecular Weight | 376.93 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | 3-(4-chlorophenyl)-1-[(3R)-1,1-dioxothiolan-3-yl]-1-(3-methoxypropyl)thiourea |
| SMILES | COCCCN(C(=S)Nc1ccc(Cl)cc1)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H21ClN2O3S2/c1-21-9-2-8-18(14-7-10-23(19,20)11-14)15(22)17-13-5-3-12(16)4-6-13/h3-6,14H,2,7-11H2,1H3,(H,17,22)/t14-/m1/s1 |
| InChIKey | DZBPNWKAZLPIAD-CQSZACIVSA-N |
| XLogP | 2.56 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.93 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|