C16H25ClN3O2S2+ — CID 9097743
3-[(4-chlorophenyl)carbamothioyl-[(3S)-1,1-dioxothiolan-3-yl]amino]propyl-dimethylazanium (PubChem CID 9097743) has the molecular formula C16H25ClN3O2S2+ and a molecular weight of 390.98 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)carbamothioyl-[(3S)-1,1-dioxothiolan-3-yl]amino]propyl-dimethylazanium.
| Compound Name | 3-[(4-chlorophenyl)carbamothioyl-[(3S)-1,1-dioxothiolan-3-yl]amino]propyl-dimethylazanium |
|---|---|
| PubChem CID | 9097743 |
| Molecular Formula | C16H25ClN3O2S2+ |
| Molecular Weight | 390.98 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | 3-[(4-chlorophenyl)carbamothioyl-[(3S)-1,1-dioxothiolan-3-yl]amino]propyl-dimethylazanium |
| SMILES | C[NH+](C)CCCN(C(=S)Nc1ccc(Cl)cc1)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H24ClN3O2S2/c1-19(2)9-3-10-20(15-8-11-24(21,22)12-15)16(23)18-14-6-4-13(17)5-7-14/h4-7,15H,3,8-12H2,1-2H3,(H,18,23)/p+1/t15-/m0/s1 |
| InChIKey | XMDUWQTWWQXZFI-HNNXBMFYSA-O |
| XLogP | 1.06 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.98 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|