C18H30N3O2S2+ — CID 9097755
3-[[(3R)-1,1-dioxothiolan-3-yl]-(2-phenylethylcarbamothioyl)amino]propyl-dimethylazanium (PubChem CID 9097755) has the molecular formula C18H30N3O2S2+ and a molecular weight of 384.59 g/mol. Its IUPAC name is 3-[[(3R)-1,1-dioxothiolan-3-yl]-(2-phenylethylcarbamothioyl)amino]propyl-dimethylazanium.
| Compound Name | 3-[[(3R)-1,1-dioxothiolan-3-yl]-(2-phenylethylcarbamothioyl)amino]propyl-dimethylazanium |
|---|---|
| PubChem CID | 9097755 |
| Molecular Formula | C18H30N3O2S2+ |
| Molecular Weight | 384.59 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 3-[[(3R)-1,1-dioxothiolan-3-yl]-(2-phenylethylcarbamothioyl)amino]propyl-dimethylazanium |
| SMILES | C[NH+](C)CCCN(C(=S)NCCc1ccccc1)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H29N3O2S2/c1-20(2)12-6-13-21(17-10-14-25(22,23)15-17)18(24)19-11-9-16-7-4-3-5-8-16/h3-5,7-8,17H,6,9-15H2,1-2H3,(H,19,24)/p+1/t17-/m1/s1 |
| InChIKey | AOPJGDBHLONKAR-QGZVFWFLSA-O |
| XLogP | 0.13 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.59 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|