C18H22N2O2S3 — CID 9231953
1-[(3R)-1,1-dioxothiolan-3-yl]-3-(2-phenylethyl)-1-(thiophen-2-ylmethyl)thiourea (PubChem CID 9231953) has the molecular formula C18H22N2O2S3 and a molecular weight of 394.59 g/mol. Its IUPAC name is 1-[(3R)-1,1-dioxothiolan-3-yl]-3-(2-phenylethyl)-1-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 1-[(3R)-1,1-dioxothiolan-3-yl]-3-(2-phenylethyl)-1-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 9231953 |
| Molecular Formula | C18H22N2O2S3 |
| Molecular Weight | 394.59 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 1-[(3R)-1,1-dioxothiolan-3-yl]-3-(2-phenylethyl)-1-(thiophen-2-ylmethyl)thiourea |
| SMILES | O=S1(=O)CC[C@@H](N(Cc2cccs2)C(=S)NCCc2ccccc2)C1 |
| InChI | InChI=1S/C18H22N2O2S3/c21-25(22)12-9-16(14-25)20(13-17-7-4-11-24-17)18(23)19-10-8-15-5-2-1-3-6-15/h1-7,11,16H,8-10,12-14H2,(H,19,23)/t16-/m1/s1 |
| InChIKey | JRQLQVUGWLVSCS-MRXNPFEDSA-N |
| XLogP | 2.85 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.59 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|