C20H23N3O5S2 — CID 25470349
N'-[2-(N-[(3S)-1,1-dioxothiolan-3-yl]anilino)-2-oxoethyl]-N-(2-thiophen-2-ylethyl)oxamide (PubChem CID 25470349) has the molecular formula C20H23N3O5S2 and a molecular weight of 449.55 g/mol. Its IUPAC name is N'-[2-(N-[(3S)-1,1-dioxothiolan-3-yl]anilino)-2-oxoethyl]-N-(2-thiophen-2-ylethyl)oxamide.
| Compound Name | N'-[2-(N-[(3S)-1,1-dioxothiolan-3-yl]anilino)-2-oxoethyl]-N-(2-thiophen-2-ylethyl)oxamide |
|---|---|
| PubChem CID | 25470349 |
| Molecular Formula | C20H23N3O5S2 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | N'-[2-(N-[(3S)-1,1-dioxothiolan-3-yl]anilino)-2-oxoethyl]-N-(2-thiophen-2-ylethyl)oxamide |
| SMILES | O=C(NCCc1cccs1)C(=O)NCC(=O)N(c1ccccc1)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C20H23N3O5S2/c24-18(13-22-20(26)19(25)21-10-8-17-7-4-11-29-17)23(15-5-2-1-3-6-15)16-9-12-30(27,28)14-16/h1-7,11,16H,8-10,12-14H2,(H,21,25)(H,22,26)/t16-/m0/s1 |
| InChIKey | BSNQGEZMGZSMDK-INIZCTEOSA-N |
| XLogP | 0.74 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|