C20H21ClN2O5S — CID 47018357
2-[(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)amino]-N-(1,1-dioxothiolan-3-yl)-N-phenylacetamide (PubChem CID 47018357) has the molecular formula C20H21ClN2O5S and a molecular weight of 436.92 g/mol. Its IUPAC name is 2-[(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)amino]-N-(1,1-dioxothiolan-3-yl)-N-phenylacetamide.
| Compound Name | 2-[(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)amino]-N-(1,1-dioxothiolan-3-yl)-N-phenylacetamide |
|---|---|
| PubChem CID | 47018357 |
| Molecular Formula | C20H21ClN2O5S |
| Molecular Weight | 436.92 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | 2-[(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)amino]-N-(1,1-dioxothiolan-3-yl)-N-phenylacetamide |
| SMILES | O=C(CNc1cc2c(cc1Cl)OCCO2)N(c1ccccc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C20H21ClN2O5S/c21-16-10-18-19(28-8-7-27-18)11-17(16)22-12-20(24)23(14-4-2-1-3-5-14)15-6-9-29(25,26)13-15/h1-5,10-11,15,22H,6-9,12-13H2 |
| InChIKey | LGXQEHAUDKDIAJ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.92 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|