C20H24N4O6S — CID 24614716
N-(1,1-dioxothiolan-3-yl)-2-[2-(2-hydroxyethylamino)-5-nitroanilino]-N-phenylacetamide (PubChem CID 24614716) has the molecular formula C20H24N4O6S and a molecular weight of 448.50 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-[2-(2-hydroxyethylamino)-5-nitroanilino]-N-phenylacetamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-[2-(2-hydroxyethylamino)-5-nitroanilino]-N-phenylacetamide |
|---|---|
| PubChem CID | 24614716 |
| Molecular Formula | C20H24N4O6S |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-[2-(2-hydroxyethylamino)-5-nitroanilino]-N-phenylacetamide |
| SMILES | O=C(CNc1cc([N+](=O)[O-])ccc1NCCO)N(c1ccccc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C20H24N4O6S/c25-10-9-21-18-7-6-16(24(27)28)12-19(18)22-13-20(26)23(15-4-2-1-3-5-15)17-8-11-31(29,30)14-17/h1-7,12,17,21-22,25H,8-11,13-14H2 |
| InChIKey | VQEDMWBORBHAKW-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 141.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|