C20H22N2O4S — CID 25355616
2-(3-acetylanilino)-N-[(3S)-1,1-dioxothiolan-3-yl]-N-phenylacetamide (PubChem CID 25355616) has the molecular formula C20H22N2O4S and a molecular weight of 386.47 g/mol. Its IUPAC name is 2-(3-acetylanilino)-N-[(3S)-1,1-dioxothiolan-3-yl]-N-phenylacetamide.
| Compound Name | 2-(3-acetylanilino)-N-[(3S)-1,1-dioxothiolan-3-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 25355616 |
| Molecular Formula | C20H22N2O4S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 2-(3-acetylanilino)-N-[(3S)-1,1-dioxothiolan-3-yl]-N-phenylacetamide |
| SMILES | CC(=O)c1cccc(NCC(=O)N(c2ccccc2)[C@H]2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C20H22N2O4S/c1-15(23)16-6-5-7-17(12-16)21-13-20(24)22(18-8-3-2-4-9-18)19-10-11-27(25,26)14-19/h2-9,12,19,21H,10-11,13-14H2,1H3/t19-/m0/s1 |
| InChIKey | YEOYXNSTBKULJJ-IBGZPJMESA-N |
| XLogP | 2.52 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |