C19H21N3O6S — CID 45354865
N-(1,1-dioxothiolan-3-yl)-2-(2-methoxy-5-nitroanilino)-N-phenylacetamide (PubChem CID 45354865) has the molecular formula C19H21N3O6S and a molecular weight of 419.46 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-(2-methoxy-5-nitroanilino)-N-phenylacetamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-(2-methoxy-5-nitroanilino)-N-phenylacetamide |
|---|---|
| PubChem CID | 45354865 |
| Molecular Formula | C19H21N3O6S |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-(2-methoxy-5-nitroanilino)-N-phenylacetamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NCC(=O)N(c1ccccc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H21N3O6S/c1-28-18-8-7-15(22(24)25)11-17(18)20-12-19(23)21(14-5-3-2-4-6-14)16-9-10-29(26,27)13-16/h2-8,11,16,20H,9-10,12-13H2,1H3 |
| InChIKey | YYRIVLVLQBLCOL-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|