C19H21N3O8S2 — CID 24679445
N-(1,1-dioxothiolan-3-yl)-4-[(2-methoxy-5-nitrophenyl)sulfamoyl]-N-methylbenzamide (PubChem CID 24679445) has the molecular formula C19H21N3O8S2 and a molecular weight of 483.52 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-4-[(2-methoxy-5-nitrophenyl)sulfamoyl]-N-methylbenzamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-4-[(2-methoxy-5-nitrophenyl)sulfamoyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 24679445 |
| Molecular Formula | C19H21N3O8S2 |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.08 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-4-[(2-methoxy-5-nitrophenyl)sulfamoyl]-N-methylbenzamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NS(=O)(=O)c1ccc(C(=O)N(C)C2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C19H21N3O8S2/c1-21(15-9-10-31(26,27)12-15)19(23)13-3-6-16(7-4-13)32(28,29)20-17-11-14(22(24)25)5-8-18(17)30-2/h3-8,11,15,20H,9-10,12H2,1-2H3 |
| InChIKey | UODRHLMKGLGBHZ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 152.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|