C20H18N4O6S2 — CID 30858576
N-(4-cyclopropyl-1,3-thiazol-2-yl)-4-[(2-methoxy-5-nitrophenyl)sulfamoyl]benzamide (PubChem CID 30858576) has the molecular formula C20H18N4O6S2 and a molecular weight of 474.52 g/mol. Its IUPAC name is N-(4-cyclopropyl-1,3-thiazol-2-yl)-4-[(2-methoxy-5-nitrophenyl)sulfamoyl]benzamide.
| Compound Name | N-(4-cyclopropyl-1,3-thiazol-2-yl)-4-[(2-methoxy-5-nitrophenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 30858576 |
| Molecular Formula | C20H18N4O6S2 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.07 |
| IUPAC Name | N-(4-cyclopropyl-1,3-thiazol-2-yl)-4-[(2-methoxy-5-nitrophenyl)sulfamoyl]benzamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NS(=O)(=O)c1ccc(C(=O)Nc2nc(C3CC3)cs2)cc1 |
| InChI | InChI=1S/C20H18N4O6S2/c1-30-18-9-6-14(24(26)27)10-16(18)23-32(28,29)15-7-4-13(5-8-15)19(25)22-20-21-17(11-31-20)12-2-3-12/h4-12,23H,2-3H2,1H3,(H,21,22,25) |
| InChIKey | BZZFVPKXECBYDV-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 140.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|