C22H29N3O5S2 — CID 24614670
2-[4-(diethylsulfamoyl)anilino]-N-(1,1-dioxothiolan-3-yl)-N-phenylacetamide (PubChem CID 24614670) has the molecular formula C22H29N3O5S2 and a molecular weight of 479.62 g/mol. Its IUPAC name is 2-[4-(diethylsulfamoyl)anilino]-N-(1,1-dioxothiolan-3-yl)-N-phenylacetamide.
| Compound Name | 2-[4-(diethylsulfamoyl)anilino]-N-(1,1-dioxothiolan-3-yl)-N-phenylacetamide |
|---|---|
| PubChem CID | 24614670 |
| Molecular Formula | C22H29N3O5S2 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | 2-[4-(diethylsulfamoyl)anilino]-N-(1,1-dioxothiolan-3-yl)-N-phenylacetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NCC(=O)N(c2ccccc2)C2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C22H29N3O5S2/c1-3-24(4-2)32(29,30)21-12-10-18(11-13-21)23-16-22(26)25(19-8-6-5-7-9-19)20-14-15-31(27,28)17-20/h5-13,20,23H,3-4,14-17H2,1-2H3 |
| InChIKey | ICUIBAKLQQMRBP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |