C21H34N2O5S2 — CID 55508263
N-butyl-3-[4-(diethylsulfamoyl)phenyl]-N-(1,1-dioxothiolan-3-yl)propanamide (PubChem CID 55508263) has the molecular formula C21H34N2O5S2 and a molecular weight of 458.65 g/mol. Its IUPAC name is N-butyl-3-[4-(diethylsulfamoyl)phenyl]-N-(1,1-dioxothiolan-3-yl)propanamide.
| Compound Name | N-butyl-3-[4-(diethylsulfamoyl)phenyl]-N-(1,1-dioxothiolan-3-yl)propanamide |
|---|---|
| PubChem CID | 55508263 |
| Molecular Formula | C21H34N2O5S2 |
| Molecular Weight | 458.65 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | N-butyl-3-[4-(diethylsulfamoyl)phenyl]-N-(1,1-dioxothiolan-3-yl)propanamide |
| SMILES | CCCCN(C(=O)CCc1ccc(S(=O)(=O)N(CC)CC)cc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C21H34N2O5S2/c1-4-7-15-23(19-14-16-29(25,26)17-19)21(24)13-10-18-8-11-20(12-9-18)30(27,28)22(5-2)6-3/h8-9,11-12,19H,4-7,10,13-17H2,1-3H3 |
| InChIKey | JJBJDXROTXRFKQ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.65 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |