C21H33NO3S — CID 134026792
N-butyl-3-(4-tert-butylphenyl)-N-(1,1-dioxothiolan-3-yl)propanamide (PubChem CID 134026792) has the molecular formula C21H33NO3S and a molecular weight of 379.57 g/mol. Its IUPAC name is N-butyl-3-(4-tert-butylphenyl)-N-(1,1-dioxothiolan-3-yl)propanamide.
| Compound Name | N-butyl-3-(4-tert-butylphenyl)-N-(1,1-dioxothiolan-3-yl)propanamide |
|---|---|
| PubChem CID | 134026792 |
| Molecular Formula | C21H33NO3S |
| Molecular Weight | 379.57 g/mol |
| Exact Mass | 379.22 |
| IUPAC Name | N-butyl-3-(4-tert-butylphenyl)-N-(1,1-dioxothiolan-3-yl)propanamide |
| SMILES | CCCCN(C(=O)CCc1ccc(C(C)(C)C)cc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C21H33NO3S/c1-5-6-14-22(19-13-15-26(24,25)16-19)20(23)12-9-17-7-10-18(11-8-17)21(2,3)4/h7-8,10-11,19H,5-6,9,12-16H2,1-4H3 |
| InChIKey | YRJWMXFZVAAXOJ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.57 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |