C21H30N2O3S — CID 60582042
N-butyl-6-tert-butyl-N-(1,1-dioxothiolan-3-yl)-1H-indole-2-carboxamide (PubChem CID 60582042) has the molecular formula C21H30N2O3S and a molecular weight of 390.55 g/mol. Its IUPAC name is N-butyl-6-tert-butyl-N-(1,1-dioxothiolan-3-yl)-1H-indole-2-carboxamide.
| Compound Name | N-butyl-6-tert-butyl-N-(1,1-dioxothiolan-3-yl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 60582042 |
| Molecular Formula | C21H30N2O3S |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | N-butyl-6-tert-butyl-N-(1,1-dioxothiolan-3-yl)-1H-indole-2-carboxamide |
| SMILES | CCCCN(C(=O)c1cc2ccc(C(C)(C)C)cc2[nH]1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C21H30N2O3S/c1-5-6-10-23(17-9-11-27(25,26)14-17)20(24)19-12-15-7-8-16(21(2,3)4)13-18(15)22-19/h7-8,12-13,17,22H,5-6,9-11,14H2,1-4H3 |
| InChIKey | BKTKHJYCXTVYDW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |