C15H23N3O3S — CID 109001942
2-[4-(dimethylamino)anilino]-N-(1,1-dioxothiolan-3-yl)-N-methylacetamide (PubChem CID 109001942) has the molecular formula C15H23N3O3S and a molecular weight of 325.43 g/mol. Its IUPAC name is 2-[4-(dimethylamino)anilino]-N-(1,1-dioxothiolan-3-yl)-N-methylacetamide.
| Compound Name | 2-[4-(dimethylamino)anilino]-N-(1,1-dioxothiolan-3-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 109001942 |
| Molecular Formula | C15H23N3O3S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 2-[4-(dimethylamino)anilino]-N-(1,1-dioxothiolan-3-yl)-N-methylacetamide |
| SMILES | CN(C)c1ccc(NCC(=O)N(C)C2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C15H23N3O3S/c1-17(2)13-6-4-12(5-7-13)16-10-15(19)18(3)14-8-9-22(20,21)11-14/h4-7,14,16H,8-11H2,1-3H3 |
| InChIKey | AHENGHMWYPVVHO-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|