C15H20N2O4S — CID 17480753
2-(4-acetamidophenyl)-N-(1,1-dioxothiolan-3-yl)-N-methylacetamide (PubChem CID 17480753) has the molecular formula C15H20N2O4S and a molecular weight of 324.40 g/mol. Its IUPAC name is 2-(4-acetamidophenyl)-N-(1,1-dioxothiolan-3-yl)-N-methylacetamide.
| Compound Name | 2-(4-acetamidophenyl)-N-(1,1-dioxothiolan-3-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 17480753 |
| Molecular Formula | C15H20N2O4S |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 2-(4-acetamidophenyl)-N-(1,1-dioxothiolan-3-yl)-N-methylacetamide |
| SMILES | CC(=O)Nc1ccc(CC(=O)N(C)C2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C15H20N2O4S/c1-11(18)16-13-5-3-12(4-6-13)9-15(19)17(2)14-7-8-22(20,21)10-14/h3-6,14H,7-10H2,1-2H3,(H,16,18) |
| InChIKey | VBOJHABKVYWHBP-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |