C14H19N3O4S — CID 108989427
N-[4-[[(1,1-dioxothiolan-3-yl)-methylcarbamoyl]amino]phenyl]acetamide (PubChem CID 108989427) has the molecular formula C14H19N3O4S and a molecular weight of 325.39 g/mol. Its IUPAC name is N-[4-[[(1,1-dioxothiolan-3-yl)-methylcarbamoyl]amino]phenyl]acetamide.
| Compound Name | N-[4-[[(1,1-dioxothiolan-3-yl)-methylcarbamoyl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 108989427 |
| Molecular Formula | C14H19N3O4S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | N-[4-[[(1,1-dioxothiolan-3-yl)-methylcarbamoyl]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)N(C)C2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C14H19N3O4S/c1-10(18)15-11-3-5-12(6-4-11)16-14(19)17(2)13-7-8-22(20,21)9-13/h3-6,13H,7-9H2,1-2H3,(H,15,18)(H,16,19) |
| InChIKey | ZTSRXSYOUSIRLW-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |