C13H16BrNO3S — CID 51238248
2-(4-bromophenyl)-N-(1,1-dioxothiolan-3-yl)-N-methylacetamide (PubChem CID 51238248) has the molecular formula C13H16BrNO3S and a molecular weight of 346.25 g/mol. Its IUPAC name is 2-(4-bromophenyl)-N-(1,1-dioxothiolan-3-yl)-N-methylacetamide.
| Compound Name | 2-(4-bromophenyl)-N-(1,1-dioxothiolan-3-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 51238248 |
| Molecular Formula | C13H16BrNO3S |
| Molecular Weight | 346.25 g/mol |
| Exact Mass | 345.00 |
| IUPAC Name | 2-(4-bromophenyl)-N-(1,1-dioxothiolan-3-yl)-N-methylacetamide |
| SMILES | CN(C(=O)Cc1ccc(Br)cc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H16BrNO3S/c1-15(12-6-7-19(17,18)9-12)13(16)8-10-2-4-11(14)5-3-10/h2-5,12H,6-9H2,1H3 |
| InChIKey | QXFKGBOJDGMRGZ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.25 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |