C12H15F3N4O4 — CID 46537081
2-[2-(2-hydroxyethylamino)-5-nitroanilino]-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 46537081) has the molecular formula C12H15F3N4O4 and a molecular weight of 336.27 g/mol. Its IUPAC name is 2-[2-(2-hydroxyethylamino)-5-nitroanilino]-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[2-(2-hydroxyethylamino)-5-nitroanilino]-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 46537081 |
| Molecular Formula | C12H15F3N4O4 |
| Molecular Weight | 336.27 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 2-[2-(2-hydroxyethylamino)-5-nitroanilino]-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | O=C(CNc1cc([N+](=O)[O-])ccc1NCCO)NCC(F)(F)F |
| InChI | InChI=1S/C12H15F3N4O4/c13-12(14,15)7-18-11(21)6-17-10-5-8(19(22)23)1-2-9(10)16-3-4-20/h1-2,5,16-17,20H,3-4,6-7H2,(H,18,21) |
| InChIKey | HGCLHFDLYYUPNM-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 116.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.27 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|