C20H26N4O4 — CID 31670165
N-[(1S)-1-(3,4-dimethylphenyl)ethyl]-2-[2-(2-hydroxyethylamino)-5-nitroanilino]acetamide (PubChem CID 31670165) has the molecular formula C20H26N4O4 and a molecular weight of 386.45 g/mol. Its IUPAC name is N-[(1S)-1-(3,4-dimethylphenyl)ethyl]-2-[2-(2-hydroxyethylamino)-5-nitroanilino]acetamide.
| Compound Name | N-[(1S)-1-(3,4-dimethylphenyl)ethyl]-2-[2-(2-hydroxyethylamino)-5-nitroanilino]acetamide |
|---|---|
| PubChem CID | 31670165 |
| Molecular Formula | C20H26N4O4 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | N-[(1S)-1-(3,4-dimethylphenyl)ethyl]-2-[2-(2-hydroxyethylamino)-5-nitroanilino]acetamide |
| SMILES | Cc1ccc([C@H](C)NC(=O)CNc2cc([N+](=O)[O-])ccc2NCCO)cc1C |
| InChI | InChI=1S/C20H26N4O4/c1-13-4-5-16(10-14(13)2)15(3)23-20(26)12-22-19-11-17(24(27)28)6-7-18(19)21-8-9-25/h4-7,10-11,15,21-22,25H,8-9,12H2,1-3H3,(H,23,26)/t15-/m0/s1 |
| InChIKey | AKYIMMUELJXMSB-HNNXBMFYSA-N |
| XLogP | 2.91 |
| TPSA | 116.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|