C20H21N5O4S — CID 26526739
2-[2-(2-hydroxyethylamino)-5-nitroanilino]-N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]acetamide (PubChem CID 26526739) has the molecular formula C20H21N5O4S and a molecular weight of 427.49 g/mol. Its IUPAC name is 2-[2-(2-hydroxyethylamino)-5-nitroanilino]-N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]acetamide.
| Compound Name | 2-[2-(2-hydroxyethylamino)-5-nitroanilino]-N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 26526739 |
| Molecular Formula | C20H21N5O4S |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | 2-[2-(2-hydroxyethylamino)-5-nitroanilino]-N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]acetamide |
| SMILES | Cc1nc(-c2cccc(NC(=O)CNc3cc([N+](=O)[O-])ccc3NCCO)c2)cs1 |
| InChI | InChI=1S/C20H21N5O4S/c1-13-23-19(12-30-13)14-3-2-4-15(9-14)24-20(27)11-22-18-10-16(25(28)29)5-6-17(18)21-7-8-26/h2-6,9-10,12,21-22,26H,7-8,11H2,1H3,(H,24,27) |
| InChIKey | GFWANARDTXHCNC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 129.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|