C17H20N4O5 — CID 9104576
2-[2-(2-hydroxyethylamino)-5-nitroanilino]-N-(2-methoxyphenyl)acetamide (PubChem CID 9104576) has the molecular formula C17H20N4O5 and a molecular weight of 360.37 g/mol. Its IUPAC name is 2-[2-(2-hydroxyethylamino)-5-nitroanilino]-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-[2-(2-hydroxyethylamino)-5-nitroanilino]-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 9104576 |
| Molecular Formula | C17H20N4O5 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 2-[2-(2-hydroxyethylamino)-5-nitroanilino]-N-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1NC(=O)CNc1cc([N+](=O)[O-])ccc1NCCO |
| InChI | InChI=1S/C17H20N4O5/c1-26-16-5-3-2-4-14(16)20-17(23)11-19-15-10-12(21(24)25)6-7-13(15)18-8-9-22/h2-7,10,18-19,22H,8-9,11H2,1H3,(H,20,23) |
| InChIKey | UYXUBXKDYXYQTP-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 125.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|