C9H9N2O5- — CID 7062941
2-(2-hydroxyethylamino)-5-nitrobenzoate (PubChem CID 7062941) has the molecular formula C9H9N2O5- and a molecular weight of 225.18 g/mol. Its IUPAC name is 2-(2-hydroxyethylamino)-5-nitrobenzoate.
| Compound Name | 2-(2-hydroxyethylamino)-5-nitrobenzoate |
|---|---|
| PubChem CID | 7062941 |
| Molecular Formula | C9H9N2O5- |
| Molecular Weight | 225.18 g/mol |
| Exact Mass | 225.05 |
| IUPAC Name | 2-(2-hydroxyethylamino)-5-nitrobenzoate |
| SMILES | O=C([O-])c1cc([N+](=O)[O-])ccc1NCCO |
| InChI | InChI=1S/C9H10N2O5/c12-4-3-10-8-2-1-6(11(15)16)5-7(8)9(13)14/h1-2,5,10,12H,3-4H2,(H,13,14)/p-1 |
| InChIKey | ZCXBRELULXFLOW-UHFFFAOYSA-M |
| XLogP | -0.64 |
| TPSA | 115.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.18 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|