C15H14N4O8 — CID 88521051
[2-[2-(2-hydroxyethylamino)-5-nitroanilino]-5-nitrophenyl] hydrogen carbonate (PubChem CID 88521051) has the molecular formula C15H14N4O8 and a molecular weight of 378.30 g/mol. Its IUPAC name is [2-[2-(2-hydroxyethylamino)-5-nitroanilino]-5-nitrophenyl] hydrogen carbonate.
| Compound Name | [2-[2-(2-hydroxyethylamino)-5-nitroanilino]-5-nitrophenyl] hydrogen carbonate |
|---|---|
| PubChem CID | 88521051 |
| Molecular Formula | C15H14N4O8 |
| Molecular Weight | 378.30 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | [2-[2-(2-hydroxyethylamino)-5-nitroanilino]-5-nitrophenyl] hydrogen carbonate |
| SMILES | O=C(O)Oc1cc([N+](=O)[O-])ccc1Nc1cc([N+](=O)[O-])ccc1NCCO |
| InChI | InChI=1S/C15H14N4O8/c20-6-5-16-11-3-1-9(18(23)24)7-13(11)17-12-4-2-10(19(25)26)8-14(12)27-15(21)22/h1-4,7-8,16-17,20H,5-6H2,(H,21,22) |
| InChIKey | SJHGDQZGWBSNMT-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 177.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.30 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|