C19H25N3O4 — CID 112799186
2-[2-[3-(3,5-dimethylphenoxy)propylamino]-4-nitroanilino]ethanol (PubChem CID 112799186) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is 2-[2-[3-(3,5-dimethylphenoxy)propylamino]-4-nitroanilino]ethanol.
| Compound Name | 2-[2-[3-(3,5-dimethylphenoxy)propylamino]-4-nitroanilino]ethanol |
|---|---|
| PubChem CID | 112799186 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 2-[2-[3-(3,5-dimethylphenoxy)propylamino]-4-nitroanilino]ethanol |
| SMILES | Cc1cc(C)cc(OCCCNc2cc([N+](=O)[O-])ccc2NCCO)c1 |
| InChI | InChI=1S/C19H25N3O4/c1-14-10-15(2)12-17(11-14)26-9-3-6-20-19-13-16(22(24)25)4-5-18(19)21-7-8-23/h4-5,10-13,20-21,23H,3,6-9H2,1-2H3 |
| InChIKey | CBKSCDKPAAISRN-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 96.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|