C20H28N2O4S — CID 109138824
1-N-(1,1-dioxothiolan-3-yl)-1-N-ethyl-2-N-(3-phenylpropyl)cyclopropane-1,2-dicarboxamide (PubChem CID 109138824) has the molecular formula C20H28N2O4S and a molecular weight of 392.52 g/mol. Its IUPAC name is 1-N-(1,1-dioxothiolan-3-yl)-1-N-ethyl-2-N-(3-phenylpropyl)cyclopropane-1,2-dicarboxamide.
| Compound Name | 1-N-(1,1-dioxothiolan-3-yl)-1-N-ethyl-2-N-(3-phenylpropyl)cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 109138824 |
| Molecular Formula | C20H28N2O4S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 1-N-(1,1-dioxothiolan-3-yl)-1-N-ethyl-2-N-(3-phenylpropyl)cyclopropane-1,2-dicarboxamide |
| SMILES | CCN(C(=O)C1CC1C(=O)NCCCc1ccccc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C20H28N2O4S/c1-2-22(16-10-12-27(25,26)14-16)20(24)18-13-17(18)19(23)21-11-6-9-15-7-4-3-5-8-15/h3-5,7-8,16-18H,2,6,9-14H2,1H3,(H,21,23) |
| InChIKey | SDMGFADJJNCZLJ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|