C23H28N2O2 — CID 109136764
1-N-benzyl-1-N-ethyl-2-N-(3-phenylpropyl)cyclopropane-1,2-dicarboxamide (PubChem CID 109136764) has the molecular formula C23H28N2O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is 1-N-benzyl-1-N-ethyl-2-N-(3-phenylpropyl)cyclopropane-1,2-dicarboxamide.
| Compound Name | 1-N-benzyl-1-N-ethyl-2-N-(3-phenylpropyl)cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 109136764 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 1-N-benzyl-1-N-ethyl-2-N-(3-phenylpropyl)cyclopropane-1,2-dicarboxamide |
| SMILES | CCN(Cc1ccccc1)C(=O)C1CC1C(=O)NCCCc1ccccc1 |
| InChI | InChI=1S/C23H28N2O2/c1-2-25(17-19-12-7-4-8-13-19)23(27)21-16-20(21)22(26)24-15-9-14-18-10-5-3-6-11-18/h3-8,10-13,20-21H,2,9,14-17H2,1H3,(H,24,26) |
| InChIKey | LFUOCGPWWFOCFW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|