C24H30N2O2 — CID 109139443
1-N-(2-tert-butylphenyl)-2-N-(3-phenylpropyl)cyclopropane-1,2-dicarboxamide (PubChem CID 109139443) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is 1-N-(2-tert-butylphenyl)-2-N-(3-phenylpropyl)cyclopropane-1,2-dicarboxamide.
| Compound Name | 1-N-(2-tert-butylphenyl)-2-N-(3-phenylpropyl)cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 109139443 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | 1-N-(2-tert-butylphenyl)-2-N-(3-phenylpropyl)cyclopropane-1,2-dicarboxamide |
| SMILES | CC(C)(C)c1ccccc1NC(=O)C1CC1C(=O)NCCCc1ccccc1 |
| InChI | InChI=1S/C24H30N2O2/c1-24(2,3)20-13-7-8-14-21(20)26-23(28)19-16-18(19)22(27)25-15-9-12-17-10-5-4-6-11-17/h4-8,10-11,13-14,18-19H,9,12,15-16H2,1-3H3,(H,25,27)(H,26,28) |
| InChIKey | LTVVTGACUYWIAN-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|